C26H19F3O3S — CID 158777181
1-phenyl-9H-fluorene;4-(trifluoromethyl)benzenesulfonic acid (PubChem CID 158777181) has the molecular formula C26H19F3O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is 1-phenyl-9H-fluorene;4-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 1-phenyl-9H-fluorene;4-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 158777181 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 1-phenyl-9H-fluorene;4-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C(F)(F)F)cc1.c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C19H14.C7H5F3O3S/c1-2-7-14(8-3-1)16-11-6-12-18-17-10-5-4-9-15(17)13-19(16)18;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-12H,13H2;1-4H,(H,11,12,13) |
| InChIKey | IQPMYLJIXHDOSJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|