C21H13F3O2S — CID 150700595
2-(9H-fluoren-1-ylsulfanyl)-4-(trifluoromethyl)benzoic acid (PubChem CID 150700595) has the molecular formula C21H13F3O2S and a molecular weight of 386.39 g/mol. Its IUPAC name is 2-(9H-fluoren-1-ylsulfanyl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(9H-fluoren-1-ylsulfanyl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 150700595 |
| Molecular Formula | C21H13F3O2S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-(9H-fluoren-1-ylsulfanyl)-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1Sc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C21H13F3O2S/c22-21(23,24)13-8-9-16(20(25)26)19(11-13)27-18-7-3-6-15-14-5-2-1-4-12(14)10-17(15)18/h1-9,11H,10H2,(H,25,26) |
| InChIKey | JLUDNJWWDYALAU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |