C38H27F3O3S — CID 158607547
1,2,3,4-tetraphenyl-9H-fluorene;trifluoromethanesulfonic acid (PubChem CID 158607547) has the molecular formula C38H27F3O3S and a molecular weight of 620.69 g/mol. Its IUPAC name is 1,2,3,4-tetraphenyl-9H-fluorene;trifluoromethanesulfonic acid.
| Compound Name | 1,2,3,4-tetraphenyl-9H-fluorene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 158607547 |
| Molecular Formula | C38H27F3O3S |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 1,2,3,4-tetraphenyl-9H-fluorene;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.c1ccc(-c2c3c(c(-c4ccccc4)c(-c4ccccc4)c2-c2ccccc2)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C37H26.CHF3O3S/c1-5-15-26(16-6-1)33-32-25-30-23-13-14-24-31(30)37(32)36(29-21-11-4-12-22-29)35(28-19-9-3-10-20-28)34(33)27-17-7-2-8-18-27;2-1(3,4)8(5,6)7/h1-24H,25H2;(H,5,6,7) |
| InChIKey | HWKPKEAYTOYGEZ-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|