C14H10O5 — CID 91457355
1,2,3,4-tetrahydroxy-10H-anthracen-9-one (PubChem CID 91457355) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroxy-10H-anthracen-9-one.
| Compound Name | 1,2,3,4-tetrahydroxy-10H-anthracen-9-one |
|---|---|
| PubChem CID | 91457355 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1,2,3,4-tetrahydroxy-10H-anthracen-9-one |
| SMILES | O=C1c2ccccc2Cc2c(O)c(O)c(O)c(O)c21 |
| InChI | InChI=1S/C14H10O5/c15-10-7-4-2-1-3-6(7)5-8-9(10)12(17)14(19)13(18)11(8)16/h1-4,16-19H,5H2 |
| InChIKey | UJJXSZLNJPOPBB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|