C16H14O — CID 100914038
2,3-dideuterio-1,4-bis(trideuteriomethyl)-10H-anthracen-9-one (PubChem CID 100914038) has the molecular formula C16H14O and a molecular weight of 230.34 g/mol. Its IUPAC name is 2,3-dideuterio-1,4-bis(trideuteriomethyl)-10H-anthracen-9-one.
| Compound Name | 2,3-dideuterio-1,4-bis(trideuteriomethyl)-10H-anthracen-9-one |
|---|---|
| PubChem CID | 100914038 |
| Molecular Formula | C16H14O |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,3-dideuterio-1,4-bis(trideuteriomethyl)-10H-anthracen-9-one |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])[2H])c2c(c1C([2H])([2H])[2H])Cc1ccccc1C2=O |
| InChI | InChI=1S/C16H14O/c1-10-7-8-11(2)15-14(10)9-12-5-3-4-6-13(12)16(15)17/h3-8H,9H2,1-2H3/i1D3,2D3,7D,8D |
| InChIKey | FDRVVBCMADRHMK-SKJDFIQESA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |