C22H18O5 — CID 134120096
(12-acetyloxy-11-oxo-4,6-dihydro-1H-tetracen-5-yl) acetate (PubChem CID 134120096) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is (12-acetyloxy-11-oxo-4,6-dihydro-1H-tetracen-5-yl) acetate.
| Compound Name | (12-acetyloxy-11-oxo-4,6-dihydro-1H-tetracen-5-yl) acetate |
|---|---|
| PubChem CID | 134120096 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (12-acetyloxy-11-oxo-4,6-dihydro-1H-tetracen-5-yl) acetate |
| SMILES | CC(=O)Oc1c2c(c(OC(C)=O)c3c1Cc1ccccc1C3=O)CC=CC2 |
| InChI | InChI=1S/C22H18O5/c1-12(23)26-21-16-9-5-6-10-17(16)22(27-13(2)24)19-18(21)11-14-7-3-4-8-15(14)20(19)25/h3-8H,9-11H2,1-2H3 |
| InChIKey | GEEBXCDZTFCREF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|