C16H8N2OS2 — CID 140979793
10-oxo-1,4-bis(sulfanyl)-9H-anthracene-2,3-dicarbonitrile (PubChem CID 140979793) has the molecular formula C16H8N2OS2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 10-oxo-1,4-bis(sulfanyl)-9H-anthracene-2,3-dicarbonitrile.
| Compound Name | 10-oxo-1,4-bis(sulfanyl)-9H-anthracene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 140979793 |
| Molecular Formula | C16H8N2OS2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 10-oxo-1,4-bis(sulfanyl)-9H-anthracene-2,3-dicarbonitrile |
| SMILES | N#Cc1c(S)c2c(c(S)c1C#N)C(=O)c1ccccc1C2 |
| InChI | InChI=1S/C16H8N2OS2/c17-6-11-12(7-18)16(21)13-10(15(11)20)5-8-3-1-2-4-9(8)14(13)19/h1-4,20-21H,5H2 |
| InChIKey | OHVGZBFKHRDIOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|