C42H38O4S — CID 172859889
4-methylbenzenesulfonic acid;3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,2-diphenyl-9H-fluorene (PubChem CID 172859889) has the molecular formula C42H38O4S and a molecular weight of 638.83 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,2-diphenyl-9H-fluorene.
| Compound Name | 4-methylbenzenesulfonic acid;3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,2-diphenyl-9H-fluorene |
|---|---|
| PubChem CID | 172859889 |
| Molecular Formula | C42H38O4S |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 4-methylbenzenesulfonic acid;3-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1,2-diphenyl-9H-fluorene |
| SMILES | CC(C)(C)Oc1ccc(-c2cc3c(c(-c4ccccc4)c2-c2ccccc2)Cc2ccccc2-3)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C35H30O.C7H8O3S/c1-35(2,3)36-28-20-18-24(19-21-28)30-23-31-29-17-11-10-16-27(29)22-32(31)34(26-14-8-5-9-15-26)33(30)25-12-6-4-7-13-25;1-6-2-4-7(5-3-6)11(8,9)10/h4-21,23H,22H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | ZFBJUBGBKIBSTL-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|