C35H29F — CID 151991768
2,3-bis(3,5-dimethylphenyl)-1-(4-fluorophenyl)-9H-fluorene (PubChem CID 151991768) has the molecular formula C35H29F and a molecular weight of 468.62 g/mol. Its IUPAC name is 2,3-bis(3,5-dimethylphenyl)-1-(4-fluorophenyl)-9H-fluorene.
| Compound Name | 2,3-bis(3,5-dimethylphenyl)-1-(4-fluorophenyl)-9H-fluorene |
|---|---|
| PubChem CID | 151991768 |
| Molecular Formula | C35H29F |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2,3-bis(3,5-dimethylphenyl)-1-(4-fluorophenyl)-9H-fluorene |
| SMILES | Cc1cc(C)cc(-c2cc3c(c(-c4ccc(F)cc4)c2-c2cc(C)cc(C)c2)Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C35H29F/c1-21-13-22(2)16-27(15-21)31-20-32-30-8-6-5-7-26(30)19-33(32)34(25-9-11-29(36)12-10-25)35(31)28-17-23(3)14-24(4)18-28/h5-18,20H,19H2,1-4H3 |
| InChIKey | UEVBHVYBLOVPBA-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |