About 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide
4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide (PubChem CID 23936503) has the molecular formula C13H12N2O2S2
and a molecular weight of 292.39 g/mol. Its IUPAC name is 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide |
| PubChem CID | 23936503 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S=Nc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12N2O2S2/c1-11-7-9-13(10-8-11)19(16,17)15-18-14-12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | AJWZRBBEBFERNC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide?
The IUPAC name of 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide (CID 23936503) is 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide?
The canonical SMILES for 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide is Cc1ccc(S(=O)(=O)N=S=Nc2ccccc2)cc1.
What is the InChIKey of 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide?
The InChIKey is AJWZRBBEBFERNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S2/c1-11-7-9-13(10-8-11)19(16,17)15-18-14-12-5-3-2-4-6-12/h2-10H,1H3.
What are the key properties of 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide?
4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide has a molecular weight of 292.39 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(phenylimino-λ4-sulfanylidene)benzenesulfonamide is sourced from PubChem (CID 23936503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).