C40H34N2O4P2S2 — CID 134875992
4-methyl-N-[2-[(4-methylphenyl)sulfonylimino-diphenyl-λ5-phosphanyl]ethynyl-diphenyl-λ5-phosphanylidene]benzenesulfonamide (PubChem CID 134875992) has the molecular formula C40H34N2O4P2S2 and a molecular weight of 732.80 g/mol. Its IUPAC name is 4-methyl-N-[2-[(4-methylphenyl)sulfonylimino-diphenyl-λ5-phosphanyl]ethynyl-diphenyl-λ5-phosphanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[(4-methylphenyl)sulfonylimino-diphenyl-λ5-phosphanyl]ethynyl-diphenyl-λ5-phosphanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 134875992 |
| Molecular Formula | C40H34N2O4P2S2 |
| Molecular Weight | 732.80 g/mol |
| Exact Mass | 732.14 |
| IUPAC Name | 4-methyl-N-[2-[(4-methylphenyl)sulfonylimino-diphenyl-λ5-phosphanyl]ethynyl-diphenyl-λ5-phosphanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=P(C#CP(=NS(=O)(=O)c2ccc(C)cc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H34N2O4P2S2/c1-33-23-27-39(28-24-33)49(43,44)41-47(35-15-7-3-8-16-35,36-17-9-4-10-18-36)31-32-48(37-19-11-5-12-20-37,38-21-13-6-14-22-38)42-50(45,46)40-29-25-34(2)26-30-40/h3-30H,1-2H3 |
| InChIKey | SGDVZDFUQSFTIC-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 93.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.80 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|