About N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide
N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide (PubChem CID 139078728) has the molecular formula C52H46N4O6P2S2
and a molecular weight of 949.04 g/mol. Its IUPAC name is N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide |
| PubChem CID | 139078728 |
| Molecular Formula | C52H46N4O6P2S2 |
| Molecular Weight | 949.04 g/mol |
| Exact Mass | 948.23 |
| IUPAC Name | N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.CC(=O)Nc1ccc(S(=O)(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C26H23N2O3PS/c2*1-21(29)27-22-17-19-26(20-18-22)33(30,31)28-32(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2*2-20H,1H3,(H,27,29) |
| InChIKey | ITQKVPLAAFATKY-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 151.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 949.04 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide?
The IUPAC name of N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide (CID 139078728) is N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide.
What is the SMILES notation for N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide?
The canonical SMILES for N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide is CC(=O)Nc1ccc(S(=O)(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.CC(=O)Nc1ccc(S(=O)(=O)N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide?
The InChIKey is ITQKVPLAAFATKY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C26H23N2O3PS/c2*1-21(29)27-22-17-19-26(20-18-22)33(30,31)28-32(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2*2-20H,1H3,(H,27,29).
What are the key properties of N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide?
N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide has a molecular weight of 949.04 g/mol, XLogP of 9.02, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(triphenyl-λ5-phosphanylidene)amino]sulfonylphenyl]acetamide is sourced from PubChem (CID 139078728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).