C15H26NO5PS — CID 165163809
N-[hydroxy-bis[(2-methylpropan-2-yl)oxy]-λ5-phosphanylidene]-4-methylbenzenesulfonamide (PubChem CID 165163809) has the molecular formula C15H26NO5PS and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[hydroxy-bis[(2-methylpropan-2-yl)oxy]-λ5-phosphanylidene]-4-methylbenzenesulfonamide.
| Compound Name | N-[hydroxy-bis[(2-methylpropan-2-yl)oxy]-λ5-phosphanylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 165163809 |
| Molecular Formula | C15H26NO5PS |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[hydroxy-bis[(2-methylpropan-2-yl)oxy]-λ5-phosphanylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=P(O)(OC(C)(C)C)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H26NO5PS/c1-12-8-10-13(11-9-12)23(18,19)16-22(17,20-14(2,3)4)21-15(5,6)7/h8-11,17H,1-7H3 |
| InChIKey | FULQYWIFLMFHQL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|