C9H12N2O2S2 — CID 5368528
methyl N'-(4-methylphenyl)sulfonylcarbamimidothioate (PubChem CID 5368528) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is methyl N'-(4-methylphenyl)sulfonylcarbamimidothioate.
| Compound Name | methyl N'-(4-methylphenyl)sulfonylcarbamimidothioate |
|---|---|
| PubChem CID | 5368528 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | methyl N'-(4-methylphenyl)sulfonylcarbamimidothioate |
| SMILES | CS/C(N)=N\S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H12N2O2S2/c1-7-3-5-8(6-4-7)15(12,13)11-9(10)14-2/h3-6H,1-2H3,(H2,10,11) |
| InChIKey | ZWAMEGGTEJHAOT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|