About [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate
[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate (PubChem CID 143880078) has the molecular formula C9H11N3O2S2
and a molecular weight of 257.34 g/mol. Its IUPAC name is [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate.
Molecular Properties
| Compound Name | [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate |
| PubChem CID | 143880078 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate |
| SMILES | [H]/N=C/S/C(N)=N\S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H11N3O2S2/c1-7-2-4-8(5-3-7)16(13,14)12-9(11)15-6-10/h2-6,10H,1H3,(H2,11,12)/b10-6+ |
| InChIKey | PMJHSJLDFITEJU-UXBLZVDNSA-N |
| XLogP | 1.34 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate?
The IUPAC name of [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate (CID 143880078) is [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate.
What is the SMILES notation for [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate?
The canonical SMILES for [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate is [H]/N=C/S/C(N)=N\S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate?
The InChIKey is PMJHSJLDFITEJU-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H11N3O2S2/c1-7-2-4-8(5-3-7)16(13,14)12-9(11)15-6-10/h2-6,10H,1H3,(H2,11,12)/b10-6+.
What are the key properties of [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate?
[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate has a molecular weight of 257.34 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl] methanimidothioate is sourced from PubChem (CID 143880078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).