C22H28N4O4S4 — CID 14981602
dimethyl (1Z,4Z)-1-N,4-N-bis-(4-methylphenyl)sulfonylpiperazine-1,4-dicarboximidothioate (PubChem CID 14981602) has the molecular formula C22H28N4O4S4 and a molecular weight of 540.76 g/mol. Its IUPAC name is dimethyl (1Z,4Z)-1-N,4-N-bis-(4-methylphenyl)sulfonylpiperazine-1,4-dicarboximidothioate.
| Compound Name | dimethyl (1Z,4Z)-1-N,4-N-bis-(4-methylphenyl)sulfonylpiperazine-1,4-dicarboximidothioate |
|---|---|
| PubChem CID | 14981602 |
| Molecular Formula | C22H28N4O4S4 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | dimethyl (1Z,4Z)-1-N,4-N-bis-(4-methylphenyl)sulfonylpiperazine-1,4-dicarboximidothioate |
| SMILES | CS/C(=N\S(=O)(=O)c1ccc(C)cc1)N1CCN(/C(=N/S(=O)(=O)c2ccc(C)cc2)SC)CC1 |
| InChI | InChI=1S/C22H28N4O4S4/c1-17-5-9-19(10-6-17)33(27,28)23-21(31-3)25-13-15-26(16-14-25)22(32-4)24-34(29,30)20-11-7-18(2)8-12-20/h5-12H,13-16H2,1-4H3/b23-21-,24-22- |
| InChIKey | AZGUENFHIKRUMM-SXAUZNKPSA-N |
| XLogP | 3.44 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|