C16H25N3O2S — CID 10881850
N,N-diethyl-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide (PubChem CID 10881850) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N,N-diethyl-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide.
| Compound Name | N,N-diethyl-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 10881850 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N,N-diethyl-N'-(4-methylphenyl)sulfonylpyrrolidine-1-carboximidamide |
| SMILES | CCN(CC)/C(=N/S(=O)(=O)c1ccc(C)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-4-18(5-2)16(19-12-6-7-13-19)17-22(20,21)15-10-8-14(3)9-11-15/h8-11H,4-7,12-13H2,1-3H3/b17-16- |
| InChIKey | RZADCZOBVHNDFX-MSUUIHNZSA-N |
| XLogP | 2.48 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|