About (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane
(4-methylphenyl)-pyrrolidin-1-ylmethanone;propane (PubChem CID 143994279) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane.
Molecular Properties
| Compound Name | (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane |
| PubChem CID | 143994279 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane |
| SMILES | CCC.Cc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C12H15NO.C3H8/c1-10-4-6-11(7-5-10)12(14)13-8-2-3-9-13;1-3-2/h4-7H,2-3,8-9H2,1H3;3H2,1-2H3 |
| InChIKey | AGHOWYTYUKVKBW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane?
The IUPAC name of (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane (CID 143994279) is (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane.
What is the SMILES notation for (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane?
The canonical SMILES for (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane is CCC.Cc1ccc(C(=O)N2CCCC2)cc1.
What is the InChIKey of (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane?
The InChIKey is AGHOWYTYUKVKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C3H8/c1-10-4-6-11(7-5-10)12(14)13-8-2-3-9-13;1-3-2/h4-7H,2-3,8-9H2,1H3;3H2,1-2H3.
What are the key properties of (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane?
(4-methylphenyl)-pyrrolidin-1-ylmethanone;propane has a molecular weight of 233.35 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-pyrrolidin-1-ylmethanone;propane is sourced from PubChem (CID 143994279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).