C17H25N3O2 — CID 110365441
N,N-diethyl-4-(4-methylbenzoyl)piperazine-1-carboxamide (PubChem CID 110365441) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,N-diethyl-4-(4-methylbenzoyl)piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-(4-methylbenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110365441 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N,N-diethyl-4-(4-methylbenzoyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-4-18(5-2)17(22)20-12-10-19(11-13-20)16(21)15-8-6-14(3)7-9-15/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | YFLBZFNOTDOPKE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |