C23H28N4O3 — CID 34221114
4-(4-benzamidobenzoyl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 34221114) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-(4-benzamidobenzoyl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(4-benzamidobenzoyl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 34221114 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-(4-benzamidobenzoyl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)c2ccc(NC(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O3/c1-3-25(4-2)23(30)27-16-14-26(15-17-27)22(29)19-10-12-20(13-11-19)24-21(28)18-8-6-5-7-9-18/h5-13H,3-4,14-17H2,1-2H3,(H,24,28) |
| InChIKey | AVGVRPHVPXHQMK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |