C18H25N3O3 — CID 109046463
4-(4-acetylpiperazine-1-carbonyl)-N,N-diethylbenzamide (PubChem CID 109046463) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(4-acetylpiperazine-1-carbonyl)-N,N-diethylbenzamide.
| Compound Name | 4-(4-acetylpiperazine-1-carbonyl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 109046463 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-(4-acetylpiperazine-1-carbonyl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=O)N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-4-19(5-2)17(23)15-6-8-16(9-7-15)18(24)21-12-10-20(11-13-21)14(3)22/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | MUFCXPPLFLXSFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |