C17H25N3O2 — CID 109106739
5-(azepane-1-carbonyl)-N,N-diethylpyridine-3-carboxamide (PubChem CID 109106739) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-(azepane-1-carbonyl)-N,N-diethylpyridine-3-carboxamide.
| Compound Name | 5-(azepane-1-carbonyl)-N,N-diethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109106739 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-(azepane-1-carbonyl)-N,N-diethylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-19(4-2)16(21)14-11-15(13-18-12-14)17(22)20-9-7-5-6-8-10-20/h11-13H,3-10H2,1-2H3 |
| InChIKey | VCQXSDNTGFRXLQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |