C15H21N3O3 — CID 109103773
N,N-diethyl-5-(morpholine-4-carbonyl)pyridine-3-carboxamide (PubChem CID 109103773) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N,N-diethyl-5-(morpholine-4-carbonyl)pyridine-3-carboxamide.
| Compound Name | N,N-diethyl-5-(morpholine-4-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109103773 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N,N-diethyl-5-(morpholine-4-carbonyl)pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-17(4-2)14(19)12-9-13(11-16-10-12)15(20)18-5-7-21-8-6-18/h9-11H,3-8H2,1-2H3 |
| InChIKey | JALKKWXKQBNTML-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |