C24H31N3O2 — CID 10691980
4-[(4-acetylpiperazin-1-yl)-phenylmethyl]-N,N-diethylbenzamide (PubChem CID 10691980) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[(4-acetylpiperazin-1-yl)-phenylmethyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(4-acetylpiperazin-1-yl)-phenylmethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10691980 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-[(4-acetylpiperazin-1-yl)-phenylmethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2ccccc2)N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-4-25(5-2)24(29)22-13-11-21(12-14-22)23(20-9-7-6-8-10-20)27-17-15-26(16-18-27)19(3)28/h6-14,23H,4-5,15-18H2,1-3H3 |
| InChIKey | NZDDYXVQIGPPAR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |