C30H36N4O2 — CID 10345250
N,N-diethyl-4-[(S)-[3-[(2-phenylacetyl)amino]phenyl]-piperazin-1-ylmethyl]benzamide (PubChem CID 10345250) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N,N-diethyl-4-[(S)-[3-[(2-phenylacetyl)amino]phenyl]-piperazin-1-ylmethyl]benzamide.
| Compound Name | N,N-diethyl-4-[(S)-[3-[(2-phenylacetyl)amino]phenyl]-piperazin-1-ylmethyl]benzamide |
|---|---|
| PubChem CID | 10345250 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N,N-diethyl-4-[(S)-[3-[(2-phenylacetyl)amino]phenyl]-piperazin-1-ylmethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc([C@@H](c2cccc(NC(=O)Cc3ccccc3)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C30H36N4O2/c1-3-33(4-2)30(36)25-15-13-24(14-16-25)29(34-19-17-31-18-20-34)26-11-8-12-27(22-26)32-28(35)21-23-9-6-5-7-10-23/h5-16,22,29,31H,3-4,17-21H2,1-2H3,(H,32,35)/t29-/m0/s1 |
| InChIKey | NBDQESVNEKWQSX-LJAQVGFWSA-N |
| XLogP | 4.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |