C24H32N4O3 — CID 58928490
methyl N-[3-[(S)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate (PubChem CID 58928490) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is methyl N-[3-[(S)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate.
| Compound Name | methyl N-[3-[(S)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 58928490 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | methyl N-[3-[(S)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate |
| SMILES | CCN(CC)C(=O)c1ccc([C@@H](c2cccc(NC(=O)OC)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-4-27(5-2)23(29)19-11-9-18(10-12-19)22(28-15-13-25-14-16-28)20-7-6-8-21(17-20)26-24(30)31-3/h6-12,17,22,25H,4-5,13-16H2,1-3H3,(H,26,30)/t22-/m0/s1 |
| InChIKey | JDHMBUPSQQZUNR-QFIPXVFZSA-N |
| XLogP | 3.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |