C23H31N3O — CID 10618862
N,N-diethyl-4-[(4-methylphenyl)-piperazin-1-ylmethyl]benzamide (PubChem CID 10618862) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-methylphenyl)-piperazin-1-ylmethyl]benzamide.
| Compound Name | N,N-diethyl-4-[(4-methylphenyl)-piperazin-1-ylmethyl]benzamide |
|---|---|
| PubChem CID | 10618862 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N,N-diethyl-4-[(4-methylphenyl)-piperazin-1-ylmethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2ccc(C)cc2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C23H31N3O/c1-4-25(5-2)23(27)21-12-10-20(11-13-21)22(26-16-14-24-15-17-26)19-8-6-18(3)7-9-19/h6-13,22,24H,4-5,14-17H2,1-3H3 |
| InChIKey | DZRRVROYJXYKPV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |