C25H34N4O3 — CID 11669323
ethyl N-[3-[(R)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate (PubChem CID 11669323) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is ethyl N-[3-[(R)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[(R)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 11669323 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl N-[3-[(R)-[4-(diethylcarbamoyl)phenyl]-piperazin-1-ylmethyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc([C@@H](c2ccc(C(=O)N(CC)CC)cc2)N2CCNCC2)c1 |
| InChI | InChI=1S/C25H34N4O3/c1-4-28(5-2)24(30)20-12-10-19(11-13-20)23(29-16-14-26-15-17-29)21-8-7-9-22(18-21)27-25(31)32-6-3/h7-13,18,23,26H,4-6,14-17H2,1-3H3,(H,27,31)/t23-/m1/s1 |
| InChIKey | CDNGMTWVMGPMHX-HSZRJFAPSA-N |
| XLogP | 3.73 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |