C27H38N4O3 — CID 91007459
[3-[[4-(diethylcarbamoyl)phenyl]-(4-ethylpiperazin-1-yl)methyl]phenyl] N-ethylcarbamate (PubChem CID 91007459) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is [3-[[4-(diethylcarbamoyl)phenyl]-(4-ethylpiperazin-1-yl)methyl]phenyl] N-ethylcarbamate.
| Compound Name | [3-[[4-(diethylcarbamoyl)phenyl]-(4-ethylpiperazin-1-yl)methyl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 91007459 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [3-[[4-(diethylcarbamoyl)phenyl]-(4-ethylpiperazin-1-yl)methyl]phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1cccc(C(c2ccc(C(=O)N(CC)CC)cc2)N2CCN(CC)CC2)c1 |
| InChI | InChI=1S/C27H38N4O3/c1-5-28-27(33)34-24-11-9-10-23(20-24)25(31-18-16-29(6-2)17-19-31)21-12-14-22(15-13-21)26(32)30(7-3)8-4/h9-15,20,25H,5-8,16-19H2,1-4H3,(H,28,33) |
| InChIKey | KNIOKJAFSWGPAO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |