C23H32N4O — CID 58664222
4-[(S)-(3-aminophenyl)-(4-methylpiperazin-1-yl)methyl]-N,N-diethylbenzamide (PubChem CID 58664222) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-[(S)-(3-aminophenyl)-(4-methylpiperazin-1-yl)methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(S)-(3-aminophenyl)-(4-methylpiperazin-1-yl)methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 58664222 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 4-[(S)-(3-aminophenyl)-(4-methylpiperazin-1-yl)methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc([C@@H](c2cccc(N)c2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O/c1-4-26(5-2)23(28)19-11-9-18(10-12-19)22(20-7-6-8-21(24)17-20)27-15-13-25(3)14-16-27/h6-12,17,22H,4-5,13-16,24H2,1-3H3/t22-/m0/s1 |
| InChIKey | YXUWDBPKUYNRKJ-QFIPXVFZSA-N |
| XLogP | 3.09 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|