C26H36N4O — CID 10319981
4-[(R)-(3-aminophenyl)-[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-N,N-diethylbenzamide (PubChem CID 10319981) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-[(R)-(3-aminophenyl)-[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(R)-(3-aminophenyl)-[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10319981 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 4-[(R)-(3-aminophenyl)-[4-(cyclopropylmethyl)piperazin-1-yl]methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc([C@H](c2cccc(N)c2)N2CCN(CC3CC3)CC2)cc1 |
| InChI | InChI=1S/C26H36N4O/c1-3-29(4-2)26(31)22-12-10-21(11-13-22)25(23-6-5-7-24(27)18-23)30-16-14-28(15-17-30)19-20-8-9-20/h5-7,10-13,18,20,25H,3-4,8-9,14-17,19,27H2,1-2H3/t25-/m1/s1 |
| InChIKey | ICSHUTBTVCGHDN-RUZDIDTESA-N |
| XLogP | 3.87 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|