C27H38N4O — CID 10410679
4-[(R)-[3-(cyclopentylamino)phenyl]-piperazin-1-ylmethyl]-N,N-diethylbenzamide (PubChem CID 10410679) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is 4-[(R)-[3-(cyclopentylamino)phenyl]-piperazin-1-ylmethyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(R)-[3-(cyclopentylamino)phenyl]-piperazin-1-ylmethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10410679 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 4-[(R)-[3-(cyclopentylamino)phenyl]-piperazin-1-ylmethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc([C@H](c2cccc(NC3CCCC3)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C27H38N4O/c1-3-30(4-2)27(32)22-14-12-21(13-15-22)26(31-18-16-28-17-19-31)23-8-7-11-25(20-23)29-24-9-5-6-10-24/h7-8,11-15,20,24,26,28-29H,3-6,9-10,16-19H2,1-2H3/t26-/m1/s1 |
| InChIKey | VORWYXRBCXAJNO-AREMUKBSSA-N |
| XLogP | 4.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |