C30H38N4O — CID 69341375
N,N-diethyl-4-[[3-(N-ethylanilino)phenyl]-piperazin-1-ylmethyl]benzamide (PubChem CID 69341375) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is N,N-diethyl-4-[[3-(N-ethylanilino)phenyl]-piperazin-1-ylmethyl]benzamide.
| Compound Name | N,N-diethyl-4-[[3-(N-ethylanilino)phenyl]-piperazin-1-ylmethyl]benzamide |
|---|---|
| PubChem CID | 69341375 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | N,N-diethyl-4-[[3-(N-ethylanilino)phenyl]-piperazin-1-ylmethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2cccc(N(CC)c3ccccc3)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C30H38N4O/c1-4-32(5-2)30(35)25-17-15-24(16-18-25)29(33-21-19-31-20-22-33)26-11-10-14-28(23-26)34(6-3)27-12-8-7-9-13-27/h7-18,23,29,31H,4-6,19-22H2,1-3H3 |
| InChIKey | RNIJUYPIDYBVSV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |