C25H35N3O — CID 173193948
N,N-diethyl-4-[(R)-phenyl-(4-propylpiperazin-1-yl)methyl]benzamide (PubChem CID 173193948) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is N,N-diethyl-4-[(R)-phenyl-(4-propylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(R)-phenyl-(4-propylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 173193948 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | N,N-diethyl-4-[(R)-phenyl-(4-propylpiperazin-1-yl)methyl]benzamide |
| SMILES | CCCN1CCN([C@H](c2ccccc2)c2ccc(C(=O)N(CC)CC)cc2)CC1 |
| InChI | InChI=1S/C25H35N3O/c1-4-16-26-17-19-28(20-18-26)24(21-10-8-7-9-11-21)22-12-14-23(15-13-22)25(29)27(5-2)6-3/h7-15,24H,4-6,16-20H2,1-3H3/t24-/m1/s1 |
| InChIKey | IQBKPSJJCJIRLC-XMMPIXPASA-N |
| XLogP | 4.29 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |