C31H38N4O3 — CID 91059107
[3-[(4-benzylpiperazin-1-yl)-[4-(diethylcarbamoyl)phenyl]methyl]phenyl] N-methylcarbamate (PubChem CID 91059107) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is [3-[(4-benzylpiperazin-1-yl)-[4-(diethylcarbamoyl)phenyl]methyl]phenyl] N-methylcarbamate.
| Compound Name | [3-[(4-benzylpiperazin-1-yl)-[4-(diethylcarbamoyl)phenyl]methyl]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 91059107 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | [3-[(4-benzylpiperazin-1-yl)-[4-(diethylcarbamoyl)phenyl]methyl]phenyl] N-methylcarbamate |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2cccc(OC(=O)NC)c2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H38N4O3/c1-4-34(5-2)30(36)26-16-14-25(15-17-26)29(27-12-9-13-28(22-27)38-31(37)32-3)35-20-18-33(19-21-35)23-24-10-7-6-8-11-24/h6-17,22,29H,4-5,18-21,23H2,1-3H3,(H,32,37) |
| InChIKey | FMTAYKYTGJMCGG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |