C21H35N3O — CID 67647635
4-[2-(1,4-diazepan-1-yl)pentyl]-N,N-diethylbenzamide (PubChem CID 67647635) has the molecular formula C21H35N3O and a molecular weight of 345.53 g/mol. Its IUPAC name is 4-[2-(1,4-diazepan-1-yl)pentyl]-N,N-diethylbenzamide.
| Compound Name | 4-[2-(1,4-diazepan-1-yl)pentyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 67647635 |
| Molecular Formula | C21H35N3O |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 4-[2-(1,4-diazepan-1-yl)pentyl]-N,N-diethylbenzamide |
| SMILES | CCCC(Cc1ccc(C(=O)N(CC)CC)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C21H35N3O/c1-4-8-20(24-15-7-13-22-14-16-24)17-18-9-11-19(12-10-18)21(25)23(5-2)6-3/h9-12,20,22H,4-8,13-17H2,1-3H3 |
| InChIKey | MOAREGOIEPXSRM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |