C17H23N3O3 — CID 109053776
N,N-diethyl-3-(4-formylpiperazine-1-carbonyl)benzamide (PubChem CID 109053776) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N,N-diethyl-3-(4-formylpiperazine-1-carbonyl)benzamide.
| Compound Name | N,N-diethyl-3-(4-formylpiperazine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109053776 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N,N-diethyl-3-(4-formylpiperazine-1-carbonyl)benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)N2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-19(4-2)16(22)14-6-5-7-15(12-14)17(23)20-10-8-18(13-21)9-11-20/h5-7,12-13H,3-4,8-11H2,1-2H3 |
| InChIKey | BFRFGIZROAQLGG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|