C17H22N4O2S2 — CID 67024388
methyl N-ethyl-1-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-5-carboximidothioate (PubChem CID 67024388) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl N-ethyl-1-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-5-carboximidothioate.
| Compound Name | methyl N-ethyl-1-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-5-carboximidothioate |
|---|---|
| PubChem CID | 67024388 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl N-ethyl-1-(4-methylphenyl)sulfonyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridine-5-carboximidothioate |
| SMILES | CC/N=C(\SC)N1CCc2c(cnn2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-4-18-17(24-3)20-10-9-16-14(12-20)11-19-21(16)25(22,23)15-7-5-13(2)6-8-15/h5-8,11H,4,9-10,12H2,1-3H3/b18-17- |
| InChIKey | WICVFDNQOYRCGG-ZCXUNETKSA-N |
| XLogP | 2.53 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|