About 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone
1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone (PubChem CID 129182181) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
| PubChem CID | 129182181 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
| SMILES | CC(=O)N1CCc2c(cnn2C)C1 |
| InChI | InChI=1S/C9H13N3O/c1-7(13)12-4-3-9-8(6-12)5-10-11(9)2/h5H,3-4,6H2,1-2H3 |
| InChIKey | JSBOYVCDLGROGG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone?
The IUPAC name of 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone (CID 129182181) is 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone.
What is the SMILES notation for 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone?
The canonical SMILES for 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone is CC(=O)N1CCc2c(cnn2C)C1.
What is the InChIKey of 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone?
The InChIKey is JSBOYVCDLGROGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-7(13)12-4-3-9-8(6-12)5-10-11(9)2/h5H,3-4,6H2,1-2H3.
What are the key properties of 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone?
1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone has a molecular weight of 179.22 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)ethanone is sourced from PubChem (CID 129182181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).