About 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine
1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine (PubChem CID 145320207) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine.
Molecular Properties
| Compound Name | 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine |
| PubChem CID | 145320207 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine |
| SMILES | Cn1ncc2c1CCN(N)C2 |
| InChI | InChI=1S/C7H12N4/c1-10-7-2-3-11(8)5-6(7)4-9-10/h4H,2-3,5,8H2,1H3 |
| InChIKey | WXHCYFSUPWYYHA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine?
The IUPAC name of 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine (CID 145320207) is 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine.
What is the SMILES notation for 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine?
The canonical SMILES for 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine is Cn1ncc2c1CCN(N)C2.
What is the InChIKey of 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine?
The InChIKey is WXHCYFSUPWYYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-10-7-2-3-11(8)5-6(7)4-9-10/h4H,2-3,5,8H2,1H3.
What are the key properties of 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine?
1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine has a molecular weight of 152.20 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine is sourced from PubChem (CID 145320207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).