C7H12N4 — CID 145320207
1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine (PubChem CID 145320207) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine.
| Compound Name | 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine |
|---|---|
| PubChem CID | 145320207 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1-methyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-amine |
| SMILES | Cn1ncc2c1CCN(N)C2 |
| InChI | InChI=1S/C7H12N4/c1-10-7-2-3-11(8)5-6(7)4-9-10/h4H,2-3,5,8H2,1H3 |
| InChIKey | WXHCYFSUPWYYHA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|