C8H12N4 — CID 123594132
2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-amine (PubChem CID 123594132) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-amine.
| Compound Name | 2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 123594132 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-amine |
| SMILES | Cc1ncc2c(n1)CCN(N)C2 |
| InChI | InChI=1S/C8H12N4/c1-6-10-4-7-5-12(9)3-2-8(7)11-6/h4H,2-3,5,9H2,1H3 |
| InChIKey | RKMOYFUWGCWZBY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|