C14H14Cl2N4 — CID 24916719
6-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24916719) has the molecular formula C14H14Cl2N4 and a molecular weight of 309.20 g/mol. Its IUPAC name is 6-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24916719 |
| Molecular Formula | C14H14Cl2N4 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-[(2,6-dichloro-3-pyridinyl)methyl]-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1ncc2c(n1)CCN(Cc1ccc(Cl)nc1Cl)C2 |
| InChI | InChI=1S/C14H14Cl2N4/c1-9-17-6-11-8-20(5-4-12(11)18-9)7-10-2-3-13(15)19-14(10)16/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | DVDDOQFPAUVRPN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|