C17H20Cl2N4 — CID 24930699
2-tert-butyl-7-[(2,6-dichloro-3-pyridinyl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 24930699) has the molecular formula C17H20Cl2N4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-tert-butyl-7-[(2,6-dichloro-3-pyridinyl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
| Compound Name | 2-tert-butyl-7-[(2,6-dichloro-3-pyridinyl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 24930699 |
| Molecular Formula | C17H20Cl2N4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-tert-butyl-7-[(2,6-dichloro-3-pyridinyl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | CC(C)(C)c1ncc2c(n1)CN(Cc1ccc(Cl)nc1Cl)CC2 |
| InChI | InChI=1S/C17H20Cl2N4/c1-17(2,3)16-20-8-11-6-7-23(10-13(11)21-16)9-12-4-5-14(18)22-15(12)19/h4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | PLUKXBLDVNXFME-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|