C12H16Cl3N3O — CID 108732144
1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-2,2,2-trichloroethanone (PubChem CID 108732144) has the molecular formula C12H16Cl3N3O and a molecular weight of 324.64 g/mol. Its IUPAC name is 1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-2,2,2-trichloroethanone.
| Compound Name | 1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 108732144 |
| Molecular Formula | C12H16Cl3N3O |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-2,2,2-trichloroethanone |
| SMILES | CC(C)(C)n1ncc2c1CCN(C(=O)C(Cl)(Cl)Cl)C2 |
| InChI | InChI=1S/C12H16Cl3N3O/c1-11(2,3)18-9-4-5-17(7-8(9)6-16-18)10(19)12(13,14)15/h6H,4-5,7H2,1-3H3 |
| InChIKey | HTKGYHRUBGFZAV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|