C14H22BrN3O — CID 108732170
2-bromo-1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)butan-1-one (PubChem CID 108732170) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-bromo-1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)butan-1-one.
| Compound Name | 2-bromo-1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)butan-1-one |
|---|---|
| PubChem CID | 108732170 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-bromo-1-(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)butan-1-one |
| SMILES | CCC(Br)C(=O)N1CCc2c(cnn2C(C)(C)C)C1 |
| InChI | InChI=1S/C14H22BrN3O/c1-5-11(15)13(19)17-7-6-12-10(9-17)8-16-18(12)14(2,3)4/h8,11H,5-7,9H2,1-4H3 |
| InChIKey | BVZDDQPWZRTYIT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|