C17H19ClN4O3 — CID 108732160
(1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-(2-chloro-5-nitrophenyl)methanone (PubChem CID 108732160) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is (1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-(2-chloro-5-nitrophenyl)methanone.
| Compound Name | (1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-(2-chloro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108732160 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (1-tert-butyl-6,7-dihydro-4H-pyrazolo[4,5-c]pyridin-5-yl)-(2-chloro-5-nitrophenyl)methanone |
| SMILES | CC(C)(C)n1ncc2c1CCN(C(=O)c1cc([N+](=O)[O-])ccc1Cl)C2 |
| InChI | InChI=1S/C17H19ClN4O3/c1-17(2,3)21-15-6-7-20(10-11(15)9-19-21)16(23)13-8-12(22(24)25)4-5-14(13)18/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | VKXPYWNSKOYAED-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|