C21H20N2O2S — CID 172640486
3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole (PubChem CID 172640486) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole.
| Compound Name | 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole |
|---|---|
| PubChem CID | 172640486 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nc3c(c2-c2cccc(C)c2)C=CCC3)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-15-10-12-18(13-11-15)26(24,25)23-21(17-7-5-6-16(2)14-17)19-8-3-4-9-20(19)22-23/h3,5-8,10-14H,4,9H2,1-2H3 |
| InChIKey | MNWWRJFXQYHXOL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |