About 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole
3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole (PubChem CID 172640486) has the molecular formula C21H20N2O2S
and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole |
| PubChem CID | 172640486 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nc3c(c2-c2cccc(C)c2)C=CCC3)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-15-10-12-18(13-11-15)26(24,25)23-21(17-7-5-6-16(2)14-17)19-8-3-4-9-20(19)22-23/h3,5-8,10-14H,4,9H2,1-2H3 |
| InChIKey | MNWWRJFXQYHXOL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole?
The IUPAC name of 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole (CID 172640486) is 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole.
What is the SMILES notation for 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole?
The canonical SMILES for 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole is Cc1ccc(S(=O)(=O)n2nc3c(c2-c2cccc(C)c2)C=CCC3)cc1.
What is the InChIKey of 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole?
The InChIKey is MNWWRJFXQYHXOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O2S/c1-15-10-12-18(13-11-15)26(24,25)23-21(17-7-5-6-16(2)14-17)19-8-3-4-9-20(19)22-23/h3,5-8,10-14H,4,9H2,1-2H3.
What are the key properties of 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole?
3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole has a molecular weight of 364.47 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)-2-(4-methylphenyl)sulfonyl-6,7-dihydroindazole is sourced from PubChem (CID 172640486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).