C18H16N2O2S2 — CID 172640453
2-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-6,7-dihydroindazole (PubChem CID 172640453) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-6,7-dihydroindazole.
| Compound Name | 2-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-6,7-dihydroindazole |
|---|---|
| PubChem CID | 172640453 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-3-thiophen-2-yl-6,7-dihydroindazole |
| SMILES | Cc1ccc(S(=O)(=O)n2nc3c(c2-c2cccs2)C=CCC3)cc1 |
| InChI | InChI=1S/C18H16N2O2S2/c1-13-8-10-14(11-9-13)24(21,22)20-18(17-7-4-12-23-17)15-5-2-3-6-16(15)19-20/h2,4-5,7-12H,3,6H2,1H3 |
| InChIKey | RUWRAUQSZGKMHO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |