2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride

C9H7ClF3NO2S — CID 71380234

IUPAC2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride
SMILESCc1ccc(S(=O)(=O)N=C(Cl)C(F)(F)F)cc1
InChIInChI=1S/C9H7ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5H,1H3
InChIKeyNBPIBWTWOOLOBP-UHFFFAOYSA-N
MW285.67 g/mol
LogP2.88
Rot. Bonds2

About 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride

2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride (PubChem CID 71380234) has the molecular formula C9H7ClF3NO2S and a molecular weight of 285.67 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride.

Molecular Properties

Compound Name2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride
PubChem CID71380234
Molecular FormulaC9H7ClF3NO2S
Molecular Weight285.67 g/mol
Exact Mass284.98
IUPAC Name2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride
SMILESCc1ccc(S(=O)(=O)N=C(Cl)C(F)(F)F)cc1
InChIInChI=1S/C9H7ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5H,1H3
InChIKeyNBPIBWTWOOLOBP-UHFFFAOYSA-N
XLogP2.88
TPSA46.50 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.67
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride?
The IUPAC name of 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride (CID 71380234) is 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride.
What is the SMILES notation for 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride?
The canonical SMILES for 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride is Cc1ccc(S(=O)(=O)N=C(Cl)C(F)(F)F)cc1.
What is the InChIKey of 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride?
The InChIKey is NBPIBWTWOOLOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5H,1H3.
What are the key properties of 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride?
2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride has a molecular weight of 285.67 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride is sourced from PubChem (CID 71380234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).