C9H7ClF3NO2S — CID 71380234
2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride (PubChem CID 71380234) has the molecular formula C9H7ClF3NO2S and a molecular weight of 285.67 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride |
|---|---|
| PubChem CID | 71380234 |
| Molecular Formula | C9H7ClF3NO2S |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methylphenyl)sulfonylethanimidoyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7ClF3NO2S/c1-6-2-4-7(5-3-6)17(15,16)14-8(10)9(11,12)13/h2-5H,1H3 |
| InChIKey | NBPIBWTWOOLOBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|