C12H18N2O3S — CID 158662021
3-hydroxy-3-methyl-N'-(4-methylphenyl)sulfonylbutanimidamide (PubChem CID 158662021) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-N'-(4-methylphenyl)sulfonylbutanimidamide.
| Compound Name | 3-hydroxy-3-methyl-N'-(4-methylphenyl)sulfonylbutanimidamide |
|---|---|
| PubChem CID | 158662021 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-hydroxy-3-methyl-N'-(4-methylphenyl)sulfonylbutanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(N)CC(C)(C)O)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-9-4-6-10(7-5-9)18(16,17)14-11(13)8-12(2,3)15/h4-7,15H,8H2,1-3H3,(H2,13,14) |
| InChIKey | ZICDJLKKYZANAO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|